C22H35N3O7 — CID 142495554
3-(2,5-dioxopyrrol-1-yl)-N-[2-[[3-(2-ethyl-2-methyl-4-oxopentoxy)-2,2-dimethylpropyl]amino]-2-oxoethoxy]propanamide (PubChem CID 142495554) has the molecular formula C22H35N3O7 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[3-(2-ethyl-2-methyl-4-oxopentoxy)-2,2-dimethylpropyl]amino]-2-oxoethoxy]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[3-(2-ethyl-2-methyl-4-oxopentoxy)-2,2-dimethylpropyl]amino]-2-oxoethoxy]propanamide |
|---|---|
| PubChem CID | 142495554 |
| Molecular Formula | C22H35N3O7 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[3-(2-ethyl-2-methyl-4-oxopentoxy)-2,2-dimethylpropyl]amino]-2-oxoethoxy]propanamide |
| SMILES | CCC(C)(COCC(C)(C)CNC(=O)CONC(=O)CCN1C(=O)C=CC1=O)CC(C)=O |
| InChI | InChI=1S/C22H35N3O7/c1-6-22(5,11-16(2)26)15-31-14-21(3,4)13-23-18(28)12-32-24-17(27)9-10-25-19(29)7-8-20(25)30/h7-8H,6,9-15H2,1-5H3,(H,23,28)(H,24,27) |
| InChIKey | WQVOHMUIZYNLIX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|