C23H37N3O7 — CID 163219439
3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[(2-ethyl-2-methyl-4-oxopentoxy)methyl]-2-methylbutyl]amino]-2-oxoethoxy]propanamide (PubChem CID 163219439) has the molecular formula C23H37N3O7 and a molecular weight of 467.56 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[(2-ethyl-2-methyl-4-oxopentoxy)methyl]-2-methylbutyl]amino]-2-oxoethoxy]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[(2-ethyl-2-methyl-4-oxopentoxy)methyl]-2-methylbutyl]amino]-2-oxoethoxy]propanamide |
|---|---|
| PubChem CID | 163219439 |
| Molecular Formula | C23H37N3O7 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[(2-ethyl-2-methyl-4-oxopentoxy)methyl]-2-methylbutyl]amino]-2-oxoethoxy]propanamide |
| SMILES | CCC(C)(CNC(=O)CONC(=O)CCN1C(=O)C=CC1=O)COCC(C)(CC)CC(C)=O |
| InChI | InChI=1S/C23H37N3O7/c1-6-22(4,12-17(3)27)15-32-16-23(5,7-2)14-24-19(29)13-33-25-18(28)10-11-26-20(30)8-9-21(26)31/h8-9H,6-7,10-16H2,1-5H3,(H,24,29)(H,25,28) |
| InChIKey | IGBDVRAGXDOSAZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|