C21H34N4O6 — CID 176670536
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-4-[4-[[(2E)-2-methoxyiminoethyl]amino]-2,2-dimethyl-4-oxobutoxy]-3,3-dimethylbutanamide (PubChem CID 176670536) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-4-[4-[[(2E)-2-methoxyiminoethyl]amino]-2,2-dimethyl-4-oxobutoxy]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-4-[4-[[(2E)-2-methoxyiminoethyl]amino]-2,2-dimethyl-4-oxobutoxy]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 176670536 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-4-[4-[[(2E)-2-methoxyiminoethyl]amino]-2,2-dimethyl-4-oxobutoxy]-3,3-dimethylbutanamide |
| SMILES | CO/N=C/CNC(=O)CC(C)(C)COCC(C)(C)CC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H34N4O6/c1-20(2,12-16(26)22-8-9-24-30-5)14-31-15-21(3,4)13-17(27)23-10-11-25-18(28)6-7-19(25)29/h6-7,9H,8,10-15H2,1-5H3,(H,22,26)(H,23,27)/b24-9+ |
| InChIKey | MMOSKHMTISUDOX-PGGKNCGUSA-N |
| XLogP | 0.63 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|