C20H13F3N4O2S — CID 162757513
2,3,6-trifluoro-4-[4-[4-methyl-2-(pyrimidin-2-yloxymethyl)-1,3-thiazol-5-yl]-2-pyridinyl]phenol (PubChem CID 162757513) has the molecular formula C20H13F3N4O2S and a molecular weight of 430.41 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-[4-[4-methyl-2-(pyrimidin-2-yloxymethyl)-1,3-thiazol-5-yl]-2-pyridinyl]phenol.
| Compound Name | 2,3,6-trifluoro-4-[4-[4-methyl-2-(pyrimidin-2-yloxymethyl)-1,3-thiazol-5-yl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 162757513 |
| Molecular Formula | C20H13F3N4O2S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2,3,6-trifluoro-4-[4-[4-methyl-2-(pyrimidin-2-yloxymethyl)-1,3-thiazol-5-yl]-2-pyridinyl]phenol |
| SMILES | Cc1nc(COc2ncccn2)sc1-c1ccnc(-c2cc(F)c(O)c(F)c2F)c1 |
| InChI | InChI=1S/C20H13F3N4O2S/c1-10-19(30-15(27-10)9-29-20-25-4-2-5-26-20)11-3-6-24-14(7-11)12-8-13(21)18(28)17(23)16(12)22/h2-8,28H,9H2,1H3 |
| InChIKey | YCHBVIWYQHEWSS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|