C29H57NO5 — CID 162764488
(Z)-N-ethylheptadec-9-enamide;[2-(2-methoxy-2-methylpropoxy)-2-methylpropyl] formate (PubChem CID 162764488) has the molecular formula C29H57NO5 and a molecular weight of 499.78 g/mol. Its IUPAC name is (Z)-N-ethylheptadec-9-enamide;[2-(2-methoxy-2-methylpropoxy)-2-methylpropyl] formate.
| Compound Name | (Z)-N-ethylheptadec-9-enamide;[2-(2-methoxy-2-methylpropoxy)-2-methylpropyl] formate |
|---|---|
| PubChem CID | 162764488 |
| Molecular Formula | C29H57NO5 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.42 |
| IUPAC Name | (Z)-N-ethylheptadec-9-enamide;[2-(2-methoxy-2-methylpropoxy)-2-methylpropyl] formate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)NCC.COC(C)(C)COC(C)(C)COC=O |
| InChI | InChI=1S/C19H37NO.C10H20O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20-4-2;1-9(2,12-5)7-14-10(3,4)6-13-8-11/h10-11H,3-9,12-18H2,1-2H3,(H,20,21);8H,6-7H2,1-5H3/b11-10-; |
| InChIKey | XGXCAFMUXFGHMM-GMFCBQQYSA-N |
| XLogP | 7.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|