C53H102N4O6 — CID 163236256
[2-(3-methoxy-3-methylbutoxy)-2-methylpropyl] N-[2-[bis[2-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]ethyl]carbamate (PubChem CID 163236256) has the molecular formula C53H102N4O6 and a molecular weight of 891.42 g/mol. Its IUPAC name is [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl] N-[2-[bis[2-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]ethyl]carbamate.
| Compound Name | [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl] N-[2-[bis[2-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 163236256 |
| Molecular Formula | C53H102N4O6 |
| Molecular Weight | 891.42 g/mol |
| Exact Mass | 890.78 |
| IUPAC Name | [2-(3-methoxy-3-methylbutoxy)-2-methylpropyl] N-[2-[bis[2-[[(Z)-octadec-9-enoyl]amino]ethyl]amino]ethyl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCN(CCNC(=O)CCCCCCC/C=C\CCCCCCCC)CCNC(=O)OCC(C)(C)OCCC(C)(C)OC |
| InChI | InChI=1S/C53H102N4O6/c1-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-49(58)54-41-44-57(46-43-56-51(60)62-48-53(5,6)63-47-40-52(3,4)61-7)45-42-55-50(59)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-2/h22-25H,8-21,26-48H2,1-7H3,(H,54,58)(H,55,59)(H,56,60)/b24-22-,25-23- |
| InChIKey | NVFZKQNBDVGACS-HKOLQMFGSA-N |
| XLogP | 12.93 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.42 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|