C33H36F4N6O — CID 162768377
bis[3-[3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methanone (PubChem CID 162768377) has the molecular formula C33H36F4N6O and a molecular weight of 608.68 g/mol. Its IUPAC name is bis[3-[3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methanone.
| Compound Name | bis[3-[3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 162768377 |
| Molecular Formula | C33H36F4N6O |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | bis[3-[3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methanone |
| SMILES | O=C(C1CC2CNC(N3N=CCC3c3cc(F)ccc3F)C2C1)C1CC2CNC(N3N=CCC3c3cc(F)ccc3F)C2C1 |
| InChI | InChI=1S/C33H36F4N6O/c34-21-1-3-27(36)25(13-21)29-5-7-40-42(29)32-23-11-17(9-19(23)15-38-32)31(44)18-10-20-16-39-33(24(20)12-18)43-30(6-8-41-43)26-14-22(35)2-4-28(26)37/h1-4,7-8,13-14,17-20,23-24,29-30,32-33,38-39H,5-6,9-12,15-16H2 |
| InChIKey | XIRFWGHPUDPUGV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |