C22H27F2N3O3 — CID 155277275
tert-butyl 5-[3-(2,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 155277275) has the molecular formula C22H27F2N3O3 and a molecular weight of 419.47 g/mol. Its IUPAC name is tert-butyl 5-[3-(2,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[3-(2,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155277275 |
| Molecular Formula | C22H27F2N3O3 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl 5-[3-(2,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C(=O)N3N=CCC3c3cc(F)ccc3F)CC2C1 |
| InChI | InChI=1S/C22H27F2N3O3/c1-22(2,3)30-21(29)26-11-14-8-13(9-15(14)12-26)20(28)27-19(6-7-25-27)17-10-16(23)4-5-18(17)24/h4-5,7,10,13-15,19H,6,8-9,11-12H2,1-3H3 |
| InChIKey | KDBXRSLUFNKUJU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |