C18H21F2N3O — CID 163972356
[3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methanone (PubChem CID 163972356) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is [3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methanone.
| Compound Name | [3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 163972356 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [3-(2,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methanone |
| SMILES | CN1CC2CC(C(=O)N3N=CCC3c3cc(F)ccc3F)CC2C1 |
| InChI | InChI=1S/C18H21F2N3O/c1-22-9-12-6-11(7-13(12)10-22)18(24)23-17(4-5-21-23)15-8-14(19)2-3-16(15)20/h2-3,5,8,11-13,17H,4,6-7,9-10H2,1H3 |
| InChIKey | SRCGWPIRNIMRSV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |