C11H11F2N — CID 83818540
6-(2,5-difluorophenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 83818540) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 6-(2,5-difluorophenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 83818540 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 6-(2,5-difluorophenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | Fc1ccc(F)c(C2C3CNCC32)c1 |
| InChI | InChI=1S/C11H11F2N/c12-6-1-2-10(13)7(3-6)11-8-4-14-5-9(8)11/h1-3,8-9,11,14H,4-5H2 |
| InChIKey | LFBGWCUPNYPBBE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |