C10H9F2N — CID 174673090
(4R)-4-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 174673090) has the molecular formula C10H9F2N and a molecular weight of 181.19 g/mol. Its IUPAC name is (4R)-4-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | (4R)-4-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 174673090 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (4R)-4-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1ccc(F)c([C@@H]2C=NCC2)c1 |
| InChI | InChI=1S/C10H9F2N/c11-8-1-2-10(12)9(5-8)7-3-4-13-6-7/h1-2,5-7H,3-4H2/t7-/m0/s1 |
| InChIKey | VHLODYHXKZZYMC-ZETCQYMHSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |