C9H18N4O2 — CID 162769148
2-acetamido-N-(N'-tert-butylcarbamimidoyl)acetamide (PubChem CID 162769148) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-acetamido-N-(N'-tert-butylcarbamimidoyl)acetamide.
| Compound Name | 2-acetamido-N-(N'-tert-butylcarbamimidoyl)acetamide |
|---|---|
| PubChem CID | 162769148 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-acetamido-N-(N'-tert-butylcarbamimidoyl)acetamide |
| SMILES | CC(=O)NCC(=O)N/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C9H18N4O2/c1-6(14)11-5-7(15)12-8(10)13-9(2,3)4/h5H2,1-4H3,(H,11,14)(H3,10,12,13,15) |
| InChIKey | FZFIJUIFIAKWPE-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|