C29H33N5O5 — CID 162769911
3-[3-oxo-7-[5-(2-oxospiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-1'-yl)pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162769911) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[3-oxo-7-[5-(2-oxospiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-1'-yl)pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[5-(2-oxospiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-1'-yl)pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162769911 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 3-[3-oxo-7-[5-(2-oxospiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-1'-yl)pentyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CCCCCN4CCC5(CC4)OC(=O)Nc4ncccc45)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H33N5O5/c35-24-11-10-23(26(36)31-24)34-18-21-19(7-4-8-20(21)27(34)37)6-2-1-3-15-33-16-12-29(13-17-33)22-9-5-14-30-25(22)32-28(38)39-29/h4-5,7-9,14,23H,1-3,6,10-13,15-18H2,(H,30,32,38)(H,31,35,36) |
| InChIKey | WPNNRIRAMJJMNH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|