C21H17F3N4O6 — CID 164584241
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate (PubChem CID 164584241) has the molecular formula C21H17F3N4O6 and a molecular weight of 478.38 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164584241 |
| Molecular Formula | C21H17F3N4O6 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[4-(trifluoromethoxy)-2-pyridinyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)Nc4cc(OC(F)(F)F)ccn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17F3N4O6/c22-21(23,24)34-13-5-6-25-16(8-13)26-20(32)33-10-11-1-2-12-9-28(19(31)14(12)7-11)15-3-4-17(29)27-18(15)30/h1-2,5-8,15H,3-4,9-10H2,(H,25,26,32)(H,27,29,30) |
| InChIKey | RDMNBDAQOZPAKK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|