C22H18N2O6 — CID 162769995
[2-hydroxy-5-[4-[3-[(6-methoxy-2-pyridinyl)amino]-3-oxopropanoyl]phenyl]phenyl] formate (PubChem CID 162769995) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-hydroxy-5-[4-[3-[(6-methoxy-2-pyridinyl)amino]-3-oxopropanoyl]phenyl]phenyl] formate.
| Compound Name | [2-hydroxy-5-[4-[3-[(6-methoxy-2-pyridinyl)amino]-3-oxopropanoyl]phenyl]phenyl] formate |
|---|---|
| PubChem CID | 162769995 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-hydroxy-5-[4-[3-[(6-methoxy-2-pyridinyl)amino]-3-oxopropanoyl]phenyl]phenyl] formate |
| SMILES | COc1cccc(NC(=O)CC(=O)c2ccc(-c3ccc(O)c(OC=O)c3)cc2)n1 |
| InChI | InChI=1S/C22H18N2O6/c1-29-22-4-2-3-20(24-22)23-21(28)12-18(27)15-7-5-14(6-8-15)16-9-10-17(26)19(11-16)30-13-25/h2-11,13,26H,12H2,1H3,(H,23,24,28) |
| InChIKey | RFRMWJCFODEVPD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|