C20H18F3N3O3Y-2 — CID 162772822
2-(6-methoxy-2-pyridinyl)-5-(2,2,2-trifluoro-1-phenylmethoxyethyl)-1,3,4-oxadiazole;prop-1-ene;yttrium (PubChem CID 162772822) has the molecular formula C20H18F3N3O3Y-2 and a molecular weight of 494.28 g/mol. Its IUPAC name is 2-(6-methoxy-2-pyridinyl)-5-(2,2,2-trifluoro-1-phenylmethoxyethyl)-1,3,4-oxadiazole;prop-1-ene;yttrium.
| Compound Name | 2-(6-methoxy-2-pyridinyl)-5-(2,2,2-trifluoro-1-phenylmethoxyethyl)-1,3,4-oxadiazole;prop-1-ene;yttrium |
|---|---|
| PubChem CID | 162772822 |
| Molecular Formula | C20H18F3N3O3Y-2 |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 2-(6-methoxy-2-pyridinyl)-5-(2,2,2-trifluoro-1-phenylmethoxyethyl)-1,3,4-oxadiazole;prop-1-ene;yttrium |
| SMILES | C=[C-]C.COc1cccc(-c2nnc([C-](OCc3ccccc3)C(F)(F)F)o2)n1.[Y] |
| InChI | InChI=1S/C17H13F3N3O3.C3H5.Y/c1-24-13-9-5-8-12(21-13)15-22-23-16(26-15)14(17(18,19)20)25-10-11-6-3-2-4-7-11;1-3-2;/h2-9H,10H2,1H3;1H2,2H3;/q2*-1; |
| InChIKey | QMGJKVJVVCBEIM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|