C36H32N2O2S — CID 162777430
3-[4-tert-butyl-6-(2-tert-butyl-5-phenylphenoxy)-2-pyridinyl]-14-oxa-6-thia-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene (PubChem CID 162777430) has the molecular formula C36H32N2O2S and a molecular weight of 556.73 g/mol. Its IUPAC name is 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylphenoxy)-2-pyridinyl]-14-oxa-6-thia-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene.
| Compound Name | 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylphenoxy)-2-pyridinyl]-14-oxa-6-thia-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene |
|---|---|
| PubChem CID | 162777430 |
| Molecular Formula | C36H32N2O2S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylphenoxy)-2-pyridinyl]-14-oxa-6-thia-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene |
| SMILES | CC(C)(C)c1cc(Oc2cc(-c3ccccc3)ccc2C(C)(C)C)nc(-c2cc3sc4cccc5oc(n2)c3c54)c1 |
| InChI | InChI=1S/C36H32N2O2S/c1-35(2,3)23-18-25(26-20-30-33-32-27(40-34(33)38-26)13-10-14-29(32)41-30)37-31(19-23)39-28-17-22(21-11-8-7-9-12-21)15-16-24(28)36(4,5)6/h7-20H,1-6H3 |
| InChIKey | FZRHGQDCWZEYBX-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |