C36H30N2O2PtS — CID 162777282
CID 162777282 (PubChem CID 162777282) has the molecular formula C36H30N2O2PtS and a molecular weight of 749.79 g/mol.
| Compound Name | CID 162777282 |
|---|---|
| PubChem CID | 162777282 |
| Molecular Formula | C36H30N2O2PtS |
| Molecular Weight | 749.79 g/mol |
| Exact Mass | 749.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Oc2nc(-c3[c-]cccc3)ccc2C(C)(C)C)nc(-c2[c-]c3oc4cccc5sc(c2)c3c45)c1.[Pt+2] |
| InChI | InChI=1S/C36H30N2O2S.Pt/c1-35(2,3)23-19-26(22-17-28-33-30(18-22)41-29-14-10-13-27(39-28)32(29)33)37-31(20-23)40-34-24(36(4,5)6)15-16-25(38-34)21-11-8-7-9-12-21;/h7-11,13-16,18-20H,1-6H3;/q-2;+2 |
| InChIKey | NMCBYCSDZLEHCV-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.79 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|