C36H30N2O3Pt — CID 162777178
3-[4-tert-butyl-6-(2-tert-butyl-5-phenylbenzene-6-id-1-yl)oxy-2-pyridinyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene;platinum(2+) (PubChem CID 162777178) has the molecular formula C36H30N2O3Pt and a molecular weight of 733.73 g/mol. Its IUPAC name is 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylbenzene-6-id-1-yl)oxy-2-pyridinyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene;platinum(2+).
| Compound Name | 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylbenzene-6-id-1-yl)oxy-2-pyridinyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene;platinum(2+) |
|---|---|
| PubChem CID | 162777178 |
| Molecular Formula | C36H30N2O3Pt |
| Molecular Weight | 733.73 g/mol |
| Exact Mass | 733.19 |
| IUPAC Name | 3-[4-tert-butyl-6-(2-tert-butyl-5-phenylbenzene-6-id-1-yl)oxy-2-pyridinyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene;platinum(2+) |
| SMILES | CC(C)(C)c1cc(Oc2[c-]c(-c3[c-]cccc3)ccc2C(C)(C)C)nc(-c2cc3oc4cccc5oc(n2)c3c45)c1.[Pt+2] |
| InChI | InChI=1S/C36H30N2O3.Pt/c1-35(2,3)23-18-25(26-20-30-33-32-27(39-30)13-10-14-28(32)41-34(33)38-26)37-31(19-23)40-29-17-22(21-11-8-7-9-12-21)15-16-24(29)36(4,5)6;/h7-11,13-16,18-20H,1-6H3;/q-2;+2 |
| InChIKey | LVQLQMKYLKRKNJ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.73 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|