C36H32N2O3 — CID 162777110
3-[3-tert-butyl-5-(2-tert-butyl-5-pyridin-2-ylphenoxy)phenyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene (PubChem CID 162777110) has the molecular formula C36H32N2O3 and a molecular weight of 540.66 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(2-tert-butyl-5-pyridin-2-ylphenoxy)phenyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene.
| Compound Name | 3-[3-tert-butyl-5-(2-tert-butyl-5-pyridin-2-ylphenoxy)phenyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene |
|---|---|
| PubChem CID | 162777110 |
| Molecular Formula | C36H32N2O3 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[3-tert-butyl-5-(2-tert-butyl-5-pyridin-2-ylphenoxy)phenyl]-6,14-dioxa-2-azatetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7(12),8,10-hexaene |
| SMILES | CC(C)(C)c1cc(Oc2cc(-c3ccccn3)ccc2C(C)(C)C)cc(-c2cc3oc4cccc5oc(n2)c3c45)c1 |
| InChI | InChI=1S/C36H32N2O3/c1-35(2,3)23-16-22(27-20-31-33-32-28(40-31)11-9-12-29(32)41-34(33)38-27)17-24(19-23)39-30-18-21(26-10-7-8-15-37-26)13-14-25(30)36(4,5)6/h7-20H,1-6H3 |
| InChIKey | XZONTZVTKPLUQN-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |