C57H35N5S — CID 162780300
12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 162780300) has the molecular formula C57H35N5S and a molecular weight of 827.04 g/mol. Its IUPAC name is 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 162780300 |
| Molecular Formula | C57H35N5S |
| Molecular Weight | 827.04 g/mol |
| Exact Mass | 826.29 |
| IUPAC Name | 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7ccccc7)c6c54)cc4c3sc3c(-c5ccccc5)cccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C57H35N5S/c1-5-18-36(19-6-1)41-28-17-29-46-47-34-40(35-48(54(47)63-53(41)46)57-59-55(37-20-7-2-8-21-37)58-56(60-57)38-22-9-3-10-23-38)62-50-31-16-14-27-43(50)45-33-32-44-42-26-13-15-30-49(42)61(51(44)52(45)62)39-24-11-4-12-25-39/h1-35H/i2D,7D,8D,20D,21D |
| InChIKey | TUIMKKKWFGMZJR-QNBZMXBHSA-N |
| XLogP | 15.10 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.04 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |