C51H30N4OS — CID 162780410
12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-[1]benzofuro[3,2-a]carbazole (PubChem CID 162780410) has the molecular formula C51H30N4OS and a molecular weight of 751.93 g/mol. Its IUPAC name is 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-[1]benzofuro[3,2-a]carbazole.
| Compound Name | 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-[1]benzofuro[3,2-a]carbazole |
|---|---|
| PubChem CID | 162780410 |
| Molecular Formula | C51H30N4OS |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.25 |
| IUPAC Name | 12-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyldibenzothiophen-2-yl]-[1]benzofuro[3,2-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccc6oc7ccccc7c6c54)cc4c3sc3c(-c5ccccc5)cccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H30N4OS/c1-4-15-31(16-5-1)35-23-14-24-38-40-29-34(55-42-25-12-10-21-36(42)37-27-28-44-45(46(37)55)39-22-11-13-26-43(39)56-44)30-41(48(40)57-47(35)38)51-53-49(32-17-6-2-7-18-32)52-50(54-51)33-19-8-3-9-20-33/h1-30H/i2D,6D,7D,17D,18D |
| InChIKey | NDEHFAMFFQQDLB-MSQAAWSKSA-N |
| XLogP | 13.90 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |