C56H35N5S — CID 162780589
9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzothiophen-2-yl]-2-pyridin-2-ylcarbazole (PubChem CID 162780589) has the molecular formula C56H35N5S and a molecular weight of 815.03 g/mol. Its IUPAC name is 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzothiophen-2-yl]-2-pyridin-2-ylcarbazole.
| Compound Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzothiophen-2-yl]-2-pyridin-2-ylcarbazole |
|---|---|
| PubChem CID | 162780589 |
| Molecular Formula | C56H35N5S |
| Molecular Weight | 815.03 g/mol |
| Exact Mass | 814.29 |
| IUPAC Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-(3-phenylphenyl)dibenzothiophen-2-yl]-2-pyridin-2-ylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccc(-c6ccccn6)cc54)cc4c3sc3c(-c5cccc(-c6ccccc6)c5)cccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C56H35N5S/c1-4-16-36(17-5-1)39-22-14-23-40(32-39)43-25-15-26-46-47-34-42(61-50-28-11-10-24-44(50)45-30-29-41(33-51(45)61)49-27-12-13-31-57-49)35-48(53(47)62-52(43)46)56-59-54(37-18-6-2-7-19-37)58-55(60-56)38-20-8-3-9-21-38/h1-35H/i2D,6D,7D,18D,19D |
| InChIKey | GBEMOVPQWBFSIF-MPJLPZPGSA-N |
| XLogP | 14.73 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.03 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |