C32H37NO5 — CID 162785745
tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-yloxyphenyl]butanoate (PubChem CID 162785745) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-yloxyphenyl]butanoate.
| Compound Name | tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-yloxyphenyl]butanoate |
|---|---|
| PubChem CID | 162785745 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | tert-butyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-yloxyphenyl]butanoate |
| SMILES | CC(C)Oc1ccc(CCCC(=O)OC(C)(C)C)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C32H37NO5/c1-21(2)37-23-18-17-22(11-10-16-30(34)38-32(3,4)5)29(19-23)33-31(35)36-20-28-26-14-8-6-12-24(26)25-13-7-9-15-27(25)28/h6-9,12-15,17-19,21,28H,10-11,16,20H2,1-5H3,(H,33,35) |
| InChIKey | KDMFKYLUQLUDAC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |