C31H35NO4 — CID 162785731
tert-butyl 4-[2-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]-4-methylphenyl]butanoate (PubChem CID 162785731) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]-4-methylphenyl]butanoate.
| Compound Name | tert-butyl 4-[2-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]-4-methylphenyl]butanoate |
|---|---|
| PubChem CID | 162785731 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 4-[2-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]-4-methylphenyl]butanoate |
| SMILES | Cc1ccc(CCCC(=O)OC(C)(C)C)c(NCC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C31H35NO4/c1-21-16-17-22(10-9-15-29(33)36-31(2,3)4)28(18-21)32-19-30(34)35-20-27-25-13-7-5-11-23(25)24-12-6-8-14-26(24)27/h5-8,11-14,16-18,27,32H,9-10,15,19-20H2,1-4H3 |
| InChIKey | OBXLYERIVHABJB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |