C31H35NO4 — CID 162785757
tert-butyl 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-ylphenyl]propanoate (PubChem CID 162785757) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is tert-butyl 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-ylphenyl]propanoate.
| Compound Name | tert-butyl 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-ylphenyl]propanoate |
|---|---|
| PubChem CID | 162785757 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-propan-2-ylphenyl]propanoate |
| SMILES | CC(C)c1ccc(CCC(=O)OC(C)(C)C)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C31H35NO4/c1-20(2)22-15-14-21(16-17-29(33)36-31(3,4)5)28(18-22)32-30(34)35-19-27-25-12-8-6-10-23(25)24-11-7-9-13-26(24)27/h6-15,18,20,27H,16-17,19H2,1-5H3,(H,32,34) |
| InChIKey | KIAPCDISTBXAEG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |