C33H46N3O5- — CID 162791411
(1R,3R)-5-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-pyrrol-1-id-2-ylbutoxy]-4-hydroxyphenyl]-1-[(1S,4R)-4-(2-hydroxyethyl)cycloheptyl]pentane-1,3-diol (PubChem CID 162791411) has the molecular formula C33H46N3O5- and a molecular weight of 564.75 g/mol. Its IUPAC name is (1R,3R)-5-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-pyrrol-1-id-2-ylbutoxy]-4-hydroxyphenyl]-1-[(1S,4R)-4-(2-hydroxyethyl)cycloheptyl]pentane-1,3-diol.
| Compound Name | (1R,3R)-5-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-pyrrol-1-id-2-ylbutoxy]-4-hydroxyphenyl]-1-[(1S,4R)-4-(2-hydroxyethyl)cycloheptyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 162791411 |
| Molecular Formula | C33H46N3O5- |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | (1R,3R)-5-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-pyrrol-1-id-2-ylbutoxy]-4-hydroxyphenyl]-1-[(1S,4R)-4-(2-hydroxyethyl)cycloheptyl]pentane-1,3-diol |
| SMILES | Nc1cc([C@H](CCOc2cc(CC[C@@H](O)C[C@@H](O)[C@H]3CCC[C@@H](CCO)CC3)ccc2O)Cc2ccc[n-]2)ccn1 |
| InChI | InChI=1S/C33H46N3O5/c34-33-21-26(12-16-36-33)27(20-28-5-2-15-35-28)14-18-41-32-19-24(8-11-30(32)39)7-10-29(38)22-31(40)25-4-1-3-23(6-9-25)13-17-37/h2,5,8,11-12,15-16,19,21,23,25,27,29,31,37-40H,1,3-4,6-7,9-10,13-14,17-18,20,22H2,(H2,34,36)/q-1/t23-,25+,27-,29-,31-/m1/s1 |
| InChIKey | GIUUBEQRWCJIJW-QZADQVKKSA-N |
| XLogP | 4.75 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |