C37H50N3O5- — CID 162876867
1-[3-[1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione (PubChem CID 162876867) has the molecular formula C37H50N3O5- and a molecular weight of 616.82 g/mol. Its IUPAC name is 1-[3-[1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione.
| Compound Name | 1-[3-[1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione |
|---|---|
| PubChem CID | 162876867 |
| Molecular Formula | C37H50N3O5- |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 1-[3-[1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)CCCCCCC2CCCCC2)cc(C(c2ccnc(N)c2)C(CO)Cc2ccc[n-]2)c1O |
| InChI | InChI=1S/C37H50N3O5/c1-45-34-21-27(15-16-32(43)24-31(42)14-8-3-2-5-10-26-11-6-4-7-12-26)20-33(37(34)44)36(28-17-19-40-35(38)23-28)29(25-41)22-30-13-9-18-39-30/h9,13,17-21,23,26,29,36,41,44H,2-8,10-12,14-16,22,24-25H2,1H3,(H2,38,40)/q-1 |
| InChIKey | QAAYQYGDFODCSC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|