C34H46N3O6- — CID 162793476
1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-14-hydroxytetradecane-3,5-dione (PubChem CID 162793476) has the molecular formula C34H46N3O6- and a molecular weight of 592.76 g/mol. Its IUPAC name is 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-14-hydroxytetradecane-3,5-dione.
| Compound Name | 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-14-hydroxytetradecane-3,5-dione |
|---|---|
| PubChem CID | 162793476 |
| Molecular Formula | C34H46N3O6- |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-pyrrol-1-id-2-ylpropyl]-4-hydroxy-5-methoxyphenyl]-14-hydroxytetradecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)CCCCCCCCCO)cc([C@@H](c2ccnc(N)c2)[C@H](CO)Cc2ccc[n-]2)c1O |
| InChI | InChI=1S/C34H46N3O6/c1-43-31-19-24(12-13-29(41)22-28(40)11-7-5-3-2-4-6-8-17-38)18-30(34(31)42)33(25-14-16-37-32(35)21-25)26(23-39)20-27-10-9-15-36-27/h9-10,14-16,18-19,21,26,33,38-39,42H,2-8,11-13,17,20,22-23H2,1H3,(H2,35,37)/q-1/t26-,33-/m0/s1 |
| InChIKey | HOPONRWKIMUZDJ-UBOZLPQGSA-N |
| XLogP | 4.89 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|