C34H47N3O5 — CID 162794622
1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-[(5-ethyl-1H-pyrrol-2-yl)methyl]-3-hydroxypropyl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione (PubChem CID 162794622) has the molecular formula C34H47N3O5 and a molecular weight of 577.77 g/mol. Its IUPAC name is 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-[(5-ethyl-1H-pyrrol-2-yl)methyl]-3-hydroxypropyl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione.
| Compound Name | 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-[(5-ethyl-1H-pyrrol-2-yl)methyl]-3-hydroxypropyl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione |
|---|---|
| PubChem CID | 162794622 |
| Molecular Formula | C34H47N3O5 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | 1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-[(5-ethyl-1H-pyrrol-2-yl)methyl]-3-hydroxypropyl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione |
| SMILES | CCCCCCCC(=O)CC(=O)CCc1cc(OC)c(O)c([C@@H](c2ccnc(N)c2)[C@H](CO)Cc2ccc(CC)[nH]2)c1 |
| InChI | InChI=1S/C34H47N3O5/c1-4-6-7-8-9-10-28(39)21-29(40)14-11-23-17-30(34(41)31(18-23)42-3)33(24-15-16-36-32(35)20-24)25(22-38)19-27-13-12-26(5-2)37-27/h12-13,15-18,20,25,33,37-38,41H,4-11,14,19,21-22H2,1-3H3,(H2,35,36)/t25-,33-/m0/s1 |
| InChIKey | QUJILRREMWWJDX-JQJBXXCASA-N |
| XLogP | 6.07 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|