C34H42N3O5- — CID 162794592
1-[3-[1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione (PubChem CID 162794592) has the molecular formula C34H42N3O5- and a molecular weight of 572.73 g/mol. Its IUPAC name is 1-[3-[1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione.
| Compound Name | 1-[3-[1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione |
|---|---|
| PubChem CID | 162794592 |
| Molecular Formula | C34H42N3O5- |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 1-[3-[1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]dodecane-3,5-dione |
| SMILES | CCCCCCCC(=O)CC(=O)CCc1cc(OC)c(O)c(C2c3ccnc(N)c3C=CC2(CO)Cc2ccc[n-]2)c1 |
| InChI | InChI=1S/C34H42N3O5/c1-3-4-5-6-7-10-25(39)20-26(40)12-11-23-18-29(32(41)30(19-23)42-2)31-27-14-17-37-33(35)28(27)13-15-34(31,22-38)21-24-9-8-16-36-24/h8-9,13-19,31,38,41H,3-7,10-12,20-22H2,1-2H3,(H2,35,37)/q-1 |
| InChIKey | QVPDBSVUTWHWLI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|