C34H45N3O6 — CID 163151543
1-[3-[1-amino-6-(hydroxymethyl)-6-(1H-pyrrol-2-ylmethyl)-3,5-dihydro-2H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-4-hydroxydodecane-3,5-dione (PubChem CID 163151543) has the molecular formula C34H45N3O6 and a molecular weight of 591.75 g/mol. Its IUPAC name is 1-[3-[1-amino-6-(hydroxymethyl)-6-(1H-pyrrol-2-ylmethyl)-3,5-dihydro-2H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-4-hydroxydodecane-3,5-dione.
| Compound Name | 1-[3-[1-amino-6-(hydroxymethyl)-6-(1H-pyrrol-2-ylmethyl)-3,5-dihydro-2H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-4-hydroxydodecane-3,5-dione |
|---|---|
| PubChem CID | 163151543 |
| Molecular Formula | C34H45N3O6 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | 1-[3-[1-amino-6-(hydroxymethyl)-6-(1H-pyrrol-2-ylmethyl)-3,5-dihydro-2H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-4-hydroxydodecane-3,5-dione |
| SMILES | CCCCCCCC(=O)C(O)C(=O)CCc1cc(OC)c(O)c(C2C3=CCNC(N)=C3C=CC2(CO)Cc2ccc[nH]2)c1 |
| InChI | InChI=1S/C34H45N3O6/c1-3-4-5-6-7-10-27(39)32(42)28(40)12-11-22-18-26(31(41)29(19-22)43-2)30-24-14-17-37-33(35)25(24)13-15-34(30,21-38)20-23-9-8-16-36-23/h8-9,13-16,18-19,30,32,36-38,41-42H,3-7,10-12,17,20-21,35H2,1-2H3 |
| InChIKey | NNAJQVNDYYDMNR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 157.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|