C36H45N3O5 — CID 163040821
1-[4-hydroxy-3-[7-(hydroxymethyl)-7-(1H-pyrrol-2-ylmethyl)-2,12-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),8-tetraen-6-yl]-5-methoxyphenyl]dodecane-3,5-dione (PubChem CID 163040821) has the molecular formula C36H45N3O5 and a molecular weight of 599.77 g/mol. Its IUPAC name is 1-[4-hydroxy-3-[7-(hydroxymethyl)-7-(1H-pyrrol-2-ylmethyl)-2,12-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),8-tetraen-6-yl]-5-methoxyphenyl]dodecane-3,5-dione.
| Compound Name | 1-[4-hydroxy-3-[7-(hydroxymethyl)-7-(1H-pyrrol-2-ylmethyl)-2,12-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),8-tetraen-6-yl]-5-methoxyphenyl]dodecane-3,5-dione |
|---|---|
| PubChem CID | 163040821 |
| Molecular Formula | C36H45N3O5 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | 1-[4-hydroxy-3-[7-(hydroxymethyl)-7-(1H-pyrrol-2-ylmethyl)-2,12-diazatricyclo[7.3.1.05,13]trideca-1,3,5(13),8-tetraen-6-yl]-5-methoxyphenyl]dodecane-3,5-dione |
| SMILES | CCCCCCCC(=O)CC(=O)CCc1cc(OC)c(O)c(C2c3ccnc4c3C(=CC2(CO)Cc2ccc[nH]2)CCN4)c1 |
| InChI | InChI=1S/C36H45N3O5/c1-3-4-5-6-7-10-27(41)20-28(42)12-11-24-18-30(34(43)31(19-24)44-2)33-29-14-17-39-35-32(29)25(13-16-38-35)21-36(33,23-40)22-26-9-8-15-37-26/h8-9,14-15,17-19,21,33,37,40,43H,3-7,10-13,16,20,22-23H2,1-2H3,(H,38,39) |
| InChIKey | SMILSNAGZBIQOA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|