C39H50N3O6- — CID 163022370
(4R)-1-[3-[(5R,6S)-1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione (PubChem CID 163022370) has the molecular formula C39H50N3O6- and a molecular weight of 656.84 g/mol. Its IUPAC name is (4R)-1-[3-[(5R,6S)-1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione.
| Compound Name | (4R)-1-[3-[(5R,6S)-1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione |
|---|---|
| PubChem CID | 163022370 |
| Molecular Formula | C39H50N3O6- |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | (4R)-1-[3-[(5R,6S)-1-amino-6-(hydroxymethyl)-6-(pyrrol-1-id-2-ylmethyl)-5H-isoquinolin-5-yl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)[C@H](O)C(=O)CCCCCCC2CCCCC2)cc([C@@H]2c3ccnc(N)c3C=C[C@@]2(CO)Cc2ccc[n-]2)c1O |
| InChI | InChI=1S/C39H50N3O6/c1-48-34-23-27(15-16-33(45)37(47)32(44)14-8-3-2-5-10-26-11-6-4-7-12-26)22-31(36(34)46)35-29-18-21-42-38(40)30(29)17-19-39(35,25-43)24-28-13-9-20-41-28/h9,13,17-23,26,35,37,43,46-47H,2-8,10-12,14-16,24-25H2,1H3,(H2,40,42)/q-1/t35-,37+,39-/m0/s1 |
| InChIKey | COCNRBJYZGTWQX-VSCQPYOZSA-N |
| XLogP | 6.07 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|