C37H51N3O6 — CID 162793859
(4R)-1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione (PubChem CID 162793859) has the molecular formula C37H51N3O6 and a molecular weight of 633.83 g/mol. Its IUPAC name is (4R)-1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione.
| Compound Name | (4R)-1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione |
|---|---|
| PubChem CID | 162793859 |
| Molecular Formula | C37H51N3O6 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.38 |
| IUPAC Name | (4R)-1-[3-[(1R,2R)-1-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexyl-4-hydroxyundecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)[C@H](O)C(=O)CCCCCCC2CCCCC2)cc([C@@H](c2ccnc(N)c2)[C@H](CO)Cc2ccc[nH]2)c1O |
| InChI | InChI=1S/C37H51N3O6/c1-46-33-21-26(15-16-32(43)37(45)31(42)14-8-3-2-5-10-25-11-6-4-7-12-25)20-30(36(33)44)35(27-17-19-40-34(38)23-27)28(24-41)22-29-13-9-18-39-29/h9,13,17-21,23,25,28,35,37,39,41,44-45H,2-8,10-12,14-16,22,24H2,1H3,(H2,38,40)/t28-,35-,37+/m0/s1 |
| InChIKey | XWIJHUNRMVDOQP-QUQGEDSUSA-N |
| XLogP | 6.04 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|