C37H53N3O5 — CID 163143711
1-[3-[1-(6-amino-1,2-dihydropyridin-4-yl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione (PubChem CID 163143711) has the molecular formula C37H53N3O5 and a molecular weight of 619.85 g/mol. Its IUPAC name is 1-[3-[1-(6-amino-1,2-dihydropyridin-4-yl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione.
| Compound Name | 1-[3-[1-(6-amino-1,2-dihydropyridin-4-yl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione |
|---|---|
| PubChem CID | 163143711 |
| Molecular Formula | C37H53N3O5 |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.40 |
| IUPAC Name | 1-[3-[1-(6-amino-1,2-dihydropyridin-4-yl)-2-(hydroxymethyl)-3-(1H-pyrrol-2-yl)propyl]-4-hydroxy-5-methoxyphenyl]-11-cyclohexylundecane-3,5-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)CCCCCCC2CCCCC2)cc(C(C2=CCNC(N)=C2)C(CO)Cc2ccc[nH]2)c1O |
| InChI | InChI=1S/C37H53N3O5/c1-45-34-21-27(15-16-32(43)24-31(42)14-8-3-2-5-10-26-11-6-4-7-12-26)20-33(37(34)44)36(28-17-19-40-35(38)23-28)29(25-41)22-30-13-9-18-39-30/h9,13,17-18,20-21,23,26,29,36,39-41,44H,2-8,10-12,14-16,19,22,24-25,38H2,1H3 |
| InChIKey | KSZCLGYNWIRTNP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|