C24H24O14 — CID 162791883
(2S,3R,5S,6R)-6-[5,6-dihydroxy-2-[4-hydroxy-2-(3-hydroxypropyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 162791883) has the molecular formula C24H24O14 and a molecular weight of 536.44 g/mol. Its IUPAC name is (2S,3R,5S,6R)-6-[5,6-dihydroxy-2-[4-hydroxy-2-(3-hydroxypropyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,5S,6R)-6-[5,6-dihydroxy-2-[4-hydroxy-2-(3-hydroxypropyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162791883 |
| Molecular Formula | C24H24O14 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | (2S,3R,5S,6R)-6-[5,6-dihydroxy-2-[4-hydroxy-2-(3-hydroxypropyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@H](Oc2cc3oc(-c4ccc(O)cc4CCCO)cc(=O)c3c(O)c2O)[C@H](O)C(O)(O)[C@@H]1O |
| InChI | InChI=1S/C24H24O14/c25-5-1-2-9-6-10(26)3-4-11(9)13-7-12(27)16-14(36-13)8-15(17(28)18(16)29)37-23-21(31)24(34,35)20(30)19(38-23)22(32)33/h3-4,6-8,19-21,23,25-26,28-31,34-35H,1-2,5H2,(H,32,33)/t19-,20+,21-,23-/m0/s1 |
| InChIKey | UPPRMECRQIAULG-KGSLCBSSSA-N |
| XLogP | -0.91 |
| TPSA | 247.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|