C22H20O14 — CID 163066129
(2S,3R,5R,6R)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylic acid (PubChem CID 163066129) has the molecular formula C22H20O14 and a molecular weight of 508.39 g/mol. Its IUPAC name is (2S,3R,5R,6R)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylic acid.
| Compound Name | (2S,3R,5R,6R)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163066129 |
| Molecular Formula | C22H20O14 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | (2S,3R,5R,6R)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@](CO)(Oc2cc3oc(-c4ccc(O)cc4)cc(=O)c3c(O)c2O)[C@H](O)C(O)(O)[C@@H]1O |
| InChI | InChI=1S/C22H20O14/c23-7-21(20(31)22(32,33)18(28)17(36-21)19(29)30)35-13-6-12-14(16(27)15(13)26)10(25)5-11(34-12)8-1-3-9(24)4-2-8/h1-6,17-18,20,23-24,26-28,31-33H,7H2,(H,29,30)/t17-,18+,20-,21-/m0/s1 |
| InChIKey | FXAMSMGOAAAUQF-YHELAOLJSA-N |
| XLogP | -1.47 |
| TPSA | 247.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|