C15H15FN4O3S — CID 162800099
5-[(3-fluoro-4-pyridinyl)methyl]-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide (PubChem CID 162800099) has the molecular formula C15H15FN4O3S and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-[(3-fluoro-4-pyridinyl)methyl]-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide.
| Compound Name | 5-[(3-fluoro-4-pyridinyl)methyl]-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
|---|---|
| PubChem CID | 162800099 |
| Molecular Formula | C15H15FN4O3S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-[(3-fluoro-4-pyridinyl)methyl]-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
| SMILES | O=S1(=O)NC2CN(Cc3ccncc3F)CC2Oc2ncccc21 |
| InChI | InChI=1S/C15H15FN4O3S/c16-11-6-17-5-3-10(11)7-20-8-12-13(9-20)23-15-14(2-1-4-18-15)24(21,22)19-12/h1-6,12-13,19H,7-9H2 |
| InChIKey | HZQWOMARIFSWLV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |