C22H21FN4O3S — CID 131670278
5-[(4-fluorophenyl)methyl]-8-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide (PubChem CID 131670278) has the molecular formula C22H21FN4O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-8-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide.
| Compound Name | 5-[(4-fluorophenyl)methyl]-8-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
|---|---|
| PubChem CID | 131670278 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-8-(pyridin-2-ylmethyl)-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene 9,9-dioxide |
| SMILES | O=S1(=O)c2cccnc2OC2CN(Cc3ccc(F)cc3)CC2N1Cc1ccccn1 |
| InChI | InChI=1S/C22H21FN4O3S/c23-17-8-6-16(7-9-17)12-26-14-19-20(15-26)30-22-21(5-3-11-25-22)31(28,29)27(19)13-18-4-1-2-10-24-18/h1-11,19-20H,12-15H2 |
| InChIKey | AQRWHWFOWGMHBA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |