C11H13N3O4S — CID 125418518
1-[(3S,7R)-9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]ethanone (PubChem CID 125418518) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-[(3S,7R)-9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]ethanone.
| Compound Name | 1-[(3S,7R)-9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]ethanone |
|---|---|
| PubChem CID | 125418518 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-[(3S,7R)-9,9-dioxo-2-oxa-9λ6-thia-5,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-5-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2Oc3ncccc3S(=O)(=O)N[C@@H]2C1 |
| InChI | InChI=1S/C11H13N3O4S/c1-7(15)14-5-8-9(6-14)18-11-10(3-2-4-12-11)19(16,17)13-8/h2-4,8-9,13H,5-6H2,1H3/t8-,9+/m1/s1 |
| InChIKey | UHLZFWQVSCXWBY-BDAKNGLRSA-N |
| XLogP | -0.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |