C21H30F3N3O2 — CID 162805357
4-(cyclopentylamino)-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]oxolan-3-ol (PubChem CID 162805357) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-(cyclopentylamino)-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]oxolan-3-ol.
| Compound Name | 4-(cyclopentylamino)-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 162805357 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-(cyclopentylamino)-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]oxolan-3-ol |
| SMILES | OC1C(NC2CCCC2)COC1CN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H30F3N3O2/c22-21(23,24)15-4-3-7-17(12-15)27-10-8-26(9-11-27)13-19-20(28)18(14-29-19)25-16-5-1-2-6-16/h3-4,7,12,16,18-20,25,28H,1-2,5-6,8-11,13-14H2 |
| InChIKey | JKMKZUUKHYLMRO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |