C19H23N3O6 — CID 162809360
N-[[(2R,3S,4S,5R)-5-[2-[benzyl(methyl)amino]-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 162809360) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[[(2R,3S,4S,5R)-5-[2-[benzyl(methyl)amino]-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[[(2R,3S,4S,5R)-5-[2-[benzyl(methyl)amino]-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 162809360 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[[(2R,3S,4S,5R)-5-[2-[benzyl(methyl)amino]-2-oxoethyl]-3,4-dihydroxyoxolan-2-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@H]1O[C@H](CNC(=O)c2ccno2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23N3O6/c1-22(11-12-5-3-2-4-6-12)16(23)9-14-17(24)18(25)15(27-14)10-20-19(26)13-7-8-21-28-13/h2-8,14-15,17-18,24-25H,9-11H2,1H3,(H,20,26)/t14-,15-,17-,18-/m1/s1 |
| InChIKey | MZBMBPPNINCUDF-JOCBIADPSA-N |
| XLogP | -0.06 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |