C14H20F6O2 — CID 162809431
[(1S,3R,4S)-3,4-dimethylcyclohexyl] 2,2-bis(trifluoromethyl)butanoate (PubChem CID 162809431) has the molecular formula C14H20F6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is [(1S,3R,4S)-3,4-dimethylcyclohexyl] 2,2-bis(trifluoromethyl)butanoate.
| Compound Name | [(1S,3R,4S)-3,4-dimethylcyclohexyl] 2,2-bis(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 162809431 |
| Molecular Formula | C14H20F6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(1S,3R,4S)-3,4-dimethylcyclohexyl] 2,2-bis(trifluoromethyl)butanoate |
| SMILES | CCC(C(=O)O[C@H]1CC[C@H](C)[C@H](C)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20F6O2/c1-4-12(13(15,16)17,14(18,19)20)11(21)22-10-6-5-8(2)9(3)7-10/h8-10H,4-7H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | ATRKHGKAWMWNSE-AEJSXWLSSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |