C17H15F17O2 — CID 95239974
[(1R,3S,4R)-3,4-dimethylcyclohexyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate (PubChem CID 95239974) has the molecular formula C17H15F17O2 and a molecular weight of 574.27 g/mol. Its IUPAC name is [(1R,3S,4R)-3,4-dimethylcyclohexyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate.
| Compound Name | [(1R,3S,4R)-3,4-dimethylcyclohexyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
|---|---|
| PubChem CID | 95239974 |
| Molecular Formula | C17H15F17O2 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | [(1R,3S,4R)-3,4-dimethylcyclohexyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
| SMILES | C[C@@H]1CC[C@@H](OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C[C@@H]1C |
| InChI | InChI=1S/C17H15F17O2/c1-6-3-4-8(5-7(6)2)36-9(35)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h6-8H,3-5H2,1-2H3/t6-,7+,8-/m1/s1 |
| InChIKey | PZWBEQNGQHXORX-GJMOJQLCSA-N |
| XLogP | 7.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|