C14H21F6NO2 — CID 162811188
[(1S,3R,4S)-3,4-dimethylcyclohexyl] N-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamate (PubChem CID 162811188) has the molecular formula C14H21F6NO2 and a molecular weight of 349.32 g/mol. Its IUPAC name is [(1S,3R,4S)-3,4-dimethylcyclohexyl] N-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamate.
| Compound Name | [(1S,3R,4S)-3,4-dimethylcyclohexyl] N-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 162811188 |
| Molecular Formula | C14H21F6NO2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(1S,3R,4S)-3,4-dimethylcyclohexyl] N-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamate |
| SMILES | CCC(NC(=O)O[C@H]1CC[C@H](C)[C@H](C)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H21F6NO2/c1-4-12(13(15,16)17,14(18,19)20)21-11(22)23-10-6-5-8(2)9(3)7-10/h8-10H,4-7H2,1-3H3,(H,21,22)/t8-,9+,10-/m0/s1 |
| InChIKey | LDOLABSOIPYZJH-AEJSXWLSSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |