C24H32O8 — CID 162818944
dimethyl 10a-ethoxy-11b-formyl-7-methyl-9-oxo-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4,4-dicarboxylate (PubChem CID 162818944) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is dimethyl 10a-ethoxy-11b-formyl-7-methyl-9-oxo-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4,4-dicarboxylate.
| Compound Name | dimethyl 10a-ethoxy-11b-formyl-7-methyl-9-oxo-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4,4-dicarboxylate |
|---|---|
| PubChem CID | 162818944 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | dimethyl 10a-ethoxy-11b-formyl-7-methyl-9-oxo-1,2,3,4a,5,6,6a,7,11,11a-decahydronaphtho[2,1-f][1]benzofuran-4,4-dicarboxylate |
| SMILES | CCOC12CC3C(CCC4C(C(=O)OC)(C(=O)OC)CCCC34C=O)C(C)C1=CC(=O)O2 |
| InChI | InChI=1S/C24H32O8/c1-5-31-24-12-17-15(14(2)16(24)11-19(26)32-24)7-8-18-22(17,13-25)9-6-10-23(18,20(27)29-3)21(28)30-4/h11,13-15,17-18H,5-10,12H2,1-4H3 |
| InChIKey | XOBQCHDBHSHTED-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|