C32H48O8 — CID 162819587
[1-acetyloxy-3-butanoyloxy-10-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate (PubChem CID 162819587) has the molecular formula C32H48O8 and a molecular weight of 560.73 g/mol. Its IUPAC name is [1-acetyloxy-3-butanoyloxy-10-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate.
| Compound Name | [1-acetyloxy-3-butanoyloxy-10-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 162819587 |
| Molecular Formula | C32H48O8 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | [1-acetyloxy-3-butanoyloxy-10-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] 2-methylbutanoate |
| SMILES | C=CC(=C)CCC1(C)C(C)CC(OC)C23C(=CC(OC(=O)C(C)CC)CC12)C(OC(=O)CCC)OC3OC(C)=O |
| InChI | InChI=1S/C32H48O8/c1-10-13-27(34)39-29-24-17-23(38-28(35)20(5)12-3)18-25-31(8,15-14-19(4)11-2)21(6)16-26(36-9)32(24,25)30(40-29)37-22(7)33/h11,17,20-21,23,25-26,29-30H,2,4,10,12-16,18H2,1,3,5-9H3 |
| InChIKey | MVCWMFXWYJCOSR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|