C27H42O6 — CID 162893384
[(1S,3R,5S,6aR,7S,8S,10R,10aR)-1-hydroxy-3,10-dimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (2R)-2-methylbutanoate (PubChem CID 162893384) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is [(1S,3R,5S,6aR,7S,8S,10R,10aR)-1-hydroxy-3,10-dimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1S,3R,5S,6aR,7S,8S,10R,10aR)-1-hydroxy-3,10-dimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162893384 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(1S,3R,5S,6aR,7S,8S,10R,10aR)-1-hydroxy-3,10-dimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (2R)-2-methylbutanoate |
| SMILES | C=CC(=C)CC[C@]1(C)[C@H]2C[C@H](OC(=O)[C@H](C)CC)C=C3[C@H](OC)O[C@H](O)[C@@]32[C@H](OC)C[C@@H]1C |
| InChI | InChI=1S/C27H42O6/c1-9-16(3)11-12-26(6)18(5)13-22(30-7)27-20(24(31-8)33-25(27)29)14-19(15-21(26)27)32-23(28)17(4)10-2/h9,14,17-19,21-22,24-25,29H,1,3,10-13,15H2,2,4-8H3/t17-,18+,19-,21-,22-,24-,25+,26+,27+/m1/s1 |
| InChIKey | MMFMSRQVRZJFCQ-PUNPTIQQSA-N |
| XLogP | 4.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|