C20H23NO5 — CID 162820279
N-[2-[4-[(2R,3S)-2,3-dihydroxy-3-methyl-4-oxobutoxy]phenyl]ethyl]benzamide (PubChem CID 162820279) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-[4-[(2R,3S)-2,3-dihydroxy-3-methyl-4-oxobutoxy]phenyl]ethyl]benzamide.
| Compound Name | N-[2-[4-[(2R,3S)-2,3-dihydroxy-3-methyl-4-oxobutoxy]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 162820279 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[2-[4-[(2R,3S)-2,3-dihydroxy-3-methyl-4-oxobutoxy]phenyl]ethyl]benzamide |
| SMILES | C[C@@](O)(C=O)[C@H](O)COc1ccc(CCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-20(25,14-22)18(23)13-26-17-9-7-15(8-10-17)11-12-21-19(24)16-5-3-2-4-6-16/h2-10,14,18,23,25H,11-13H2,1H3,(H,21,24)/t18-,20-/m1/s1 |
| InChIKey | SWCGHBCMQFDCAH-UYAOXDASSA-N |
| XLogP | 1.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|